C20H38 — CID 140816107
(6Z,9Z)-17,17-dimethyloctadeca-6,9-diene (PubChem CID 140816107) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is (6Z,9Z)-17,17-dimethyloctadeca-6,9-diene.
| Compound Name | (6Z,9Z)-17,17-dimethyloctadeca-6,9-diene |
|---|---|
| PubChem CID | 140816107 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | (6Z,9Z)-17,17-dimethyloctadeca-6,9-diene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C)(C)C |
| InChI | InChI=1S/C20H38/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4/h9-10,12-13H,5-8,11,14-19H2,1-4H3/b10-9-,13-12- |
| InChIKey | MQSLDTIRGQZBFV-UTJQPWESSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|