C15H28 — CID 176739727
(4Z,7Z)-12,12-dimethyltrideca-4,7-diene (PubChem CID 176739727) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (4Z,7Z)-12,12-dimethyltrideca-4,7-diene.
| Compound Name | (4Z,7Z)-12,12-dimethyltrideca-4,7-diene |
|---|---|
| PubChem CID | 176739727 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (4Z,7Z)-12,12-dimethyltrideca-4,7-diene |
| SMILES | CCC/C=C\C/C=C\CCCC(C)(C)C |
| InChI | InChI=1S/C15H28/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h7-8,10-11H,5-6,9,12-14H2,1-4H3/b8-7-,11-10- |
| InChIKey | LBQWLXRVQWSBIZ-NQLNTKRDSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|