C23H40O — CID 155188256
(11Z,14Z,17Z)-2,2-dimethylhenicosa-11,14,17-trien-3-one (PubChem CID 155188256) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is (11Z,14Z,17Z)-2,2-dimethylhenicosa-11,14,17-trien-3-one.
| Compound Name | (11Z,14Z,17Z)-2,2-dimethylhenicosa-11,14,17-trien-3-one |
|---|---|
| PubChem CID | 155188256 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | (11Z,14Z,17Z)-2,2-dimethylhenicosa-11,14,17-trien-3-one |
| SMILES | CCC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H40O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(2,3)4/h7-8,10-11,13-14H,5-6,9,12,15-21H2,1-4H3/b8-7-,11-10-,14-13- |
| InChIKey | KOVUNLOHHOEZSF-JPFHKJGASA-N |
| XLogP | 7.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|