C18H30F3NO4 — CID 101167968
methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoate (PubChem CID 101167968) has the molecular formula C18H30F3NO4 and a molecular weight of 381.44 g/mol. Its IUPAC name is methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoate.
| Compound Name | methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoate |
|---|---|
| PubChem CID | 101167968 |
| Molecular Formula | C18H30F3NO4 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | methyl (E,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoate |
| SMILES | CCCCCC/C=C/[C@H]([C@H](NC(=O)OC(C)(C)C)C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C18H30F3NO4/c1-6-7-8-9-10-11-12-13(18(19,20)21)14(15(23)25-5)22-16(24)26-17(2,3)4/h11-14H,6-10H2,1-5H3,(H,22,24)/b12-11+/t13-,14+/m1/s1 |
| InChIKey | LNOADDVSAWLRNJ-WLDGIZNKSA-N |
| XLogP | 4.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|