C17H28F3NO4 — CID 135804705
(E,2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoic acid (PubChem CID 135804705) has the molecular formula C17H28F3NO4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (E,2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoic acid |
|---|---|
| PubChem CID | 135804705 |
| Molecular Formula | C17H28F3NO4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (E,2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)undec-4-enoic acid |
| SMILES | CCCCCC/C=C/[C@@H]([C@H](NC(=O)OC(C)(C)C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO4/c1-5-6-7-8-9-10-11-12(17(18,19)20)13(14(22)23)21-15(24)25-16(2,3)4/h10-13H,5-9H2,1-4H3,(H,21,24)(H,22,23)/b11-10+/t12-,13-/m0/s1 |
| InChIKey | VAFRRMMXOPUJIX-QFEHZMRISA-N |
| XLogP | 4.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|