C32H47NO5Si — CID 58288120
N-[[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-ethyloxolan-2-yl]methoxy]-1-[(1R,4R,7S)-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-N-methylmethanamine (PubChem CID 58288120) has the molecular formula C32H47NO5Si and a molecular weight of 553.82 g/mol. Its IUPAC name is N-[[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-ethyloxolan-2-yl]methoxy]-1-[(1R,4R,7S)-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-N-methylmethanamine.
| Compound Name | N-[[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-ethyloxolan-2-yl]methoxy]-1-[(1R,4R,7S)-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 58288120 |
| Molecular Formula | C32H47NO5Si |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | N-[[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-ethyloxolan-2-yl]methoxy]-1-[(1R,4R,7S)-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-N-methylmethanamine |
| SMILES | CC[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CON(C)C[C@H]2[C@@H]3CO[C@@]2(CC)CO3)O1 |
| InChI | InChI=1S/C32H47NO5Si/c1-7-24-19-28(30(37-24)22-36-33(6)20-27-29-21-35-32(27,8-2)23-34-29)38-39(31(3,4)5,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18,24,27-30H,7-8,19-23H2,1-6H3/t24-,27-,28-,29-,30+,32-/m0/s1 |
| InChIKey | DYTJVBWEZBXHRR-UWOVZFGRSA-N |
| XLogP | 4.56 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|