C26H35F3O6SSi — CID 134970303
[(4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl trifluoromethanesulfonate (PubChem CID 134970303) has the molecular formula C26H35F3O6SSi and a molecular weight of 560.71 g/mol. Its IUPAC name is [(4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134970303 |
| Molecular Formula | C26H35F3O6SSi |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [(4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H](COS(=O)(=O)C(F)(F)F)C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H35F3O6SSi/c1-24(2,3)37(22-12-8-6-9-13-22,23-14-10-7-11-15-23)33-17-16-20-18-21(35-25(4,5)34-20)19-32-36(30,31)26(27,28)29/h6-15,20-21H,16-19H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | WQDOSFHEZIQZHT-SFTDATJTSA-N |
| XLogP | 4.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|