C26H33F3O6SSi — CID 152735633
[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] trifluoromethanesulfonate (PubChem CID 152735633) has the molecular formula C26H33F3O6SSi and a molecular weight of 558.69 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 152735633 |
| Molecular Formula | C26H33F3O6SSi |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H](OS(=O)(=O)C(F)(F)F)[C@@H]2O1 |
| InChI | InChI=1S/C26H33F3O6SSi/c1-24(2,3)37(19-12-8-6-9-13-19,20-14-10-7-11-15-20)32-17-18-16-21(35-36(30,31)26(27,28)29)23-22(18)33-25(4,5)34-23/h6-15,18,21-23H,16-17H2,1-5H3/t18-,21+,22-,23+/m1/s1 |
| InChIKey | ZYNSRUAYOKBMTG-MSYGRNIXSA-N |
| XLogP | 4.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|