C24H34O5Si — CID 102091797
(2S,3S,4S,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol (PubChem CID 102091797) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol.
| Compound Name | (2S,3S,4S,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 102091797 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol |
| SMILES | CO[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C24H34O5Si/c1-17-21(25)20(29-23(27-5)22(17)26)16-28-30(24(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20-23,25-26H,16H2,1-5H3/t17-,20-,21-,22+,23+/m0/s1 |
| InChIKey | XQNYIHWPDXMIQX-MKCQOVQRSA-N |
| XLogP | 2.29 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|