C23H32O4Si — CID 13374022
[(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methanol (PubChem CID 13374022) has the molecular formula C23H32O4Si and a molecular weight of 400.59 g/mol. Its IUPAC name is [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methanol.
| Compound Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 13374022 |
| Molecular Formula | C23H32O4Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methanol |
| SMILES | CO[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](CO)O1 |
| InChI | InChI=1S/C23H32O4Si/c1-23(2,3)28(20-11-7-5-8-12-20,21-13-9-6-10-14-21)27-18-15-19(17-24)26-22(16-18)25-4/h5-14,18-19,22,24H,15-17H2,1-4H3/t18-,19+,22-/m1/s1 |
| InChIKey | VQORJWOLODUHOC-XQBPLPMBSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|