C27H42O6Si2 — CID 90797458
(2S,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-6-(2-trimethylsilylethoxy)oxane-3,4,5-triol (PubChem CID 90797458) has the molecular formula C27H42O6Si2 and a molecular weight of 518.80 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-6-(2-trimethylsilylethoxy)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-6-(2-trimethylsilylethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90797458 |
| Molecular Formula | C27H42O6Si2 |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2S,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-6-(2-trimethylsilylethoxy)oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C(O)[C@H]1O[C@H](OCC[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H42O6Si2/c1-27(2,3)35(19-13-9-7-10-14-19,20-15-11-8-12-16-20)25(31)24-22(29)21(28)23(30)26(33-24)32-17-18-34(4,5)6/h7-16,21-26,28-31H,17-18H2,1-6H3/t21-,22+,23+,24-,25?,26-/m0/s1 |
| InChIKey | CKKUJFBZADRZGY-DSZKRCTOSA-N |
| XLogP | 2.11 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|