C23H30FIO3Si — CID 57138515
4-[tert-butyl(diphenyl)silyl]-3-fluoro-2-(iodomethyl)-6-methoxyoxan-4-ol (PubChem CID 57138515) has the molecular formula C23H30FIO3Si and a molecular weight of 528.48 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]-3-fluoro-2-(iodomethyl)-6-methoxyoxan-4-ol.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]-3-fluoro-2-(iodomethyl)-6-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 57138515 |
| Molecular Formula | C23H30FIO3Si |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]-3-fluoro-2-(iodomethyl)-6-methoxyoxan-4-ol |
| SMILES | COC1CC(O)([Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(F)C(CI)O1 |
| InChI | InChI=1S/C23H30FIO3Si/c1-22(2,3)29(17-11-7-5-8-12-17,18-13-9-6-10-14-18)23(26)15-20(27-4)28-19(16-25)21(23)24/h5-14,19-21,26H,15-16H2,1-4H3 |
| InChIKey | BJRBPXZBMXJBJJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|