C28H41N3O3Si — CID 134845852
[(2R)-2-[(4R,5S,6S)-6-[(1R)-1-azidoethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane (PubChem CID 134845852) has the molecular formula C28H41N3O3Si and a molecular weight of 495.74 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S,6S)-6-[(1R)-1-azidoethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-2-[(4R,5S,6S)-6-[(1R)-1-azidoethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134845852 |
| Molecular Formula | C28H41N3O3Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | [(2R)-2-[(4R,5S,6S)-6-[(1R)-1-azidoethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H]1[C@@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O[C@@H]1[C@@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C28H41N3O3Si/c1-20(25-21(2)26(22(3)30-31-29)34-28(7,8)33-25)19-32-35(27(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,20-22,25-26H,19H2,1-8H3/t20-,21+,22-,25-,26+/m1/s1 |
| InChIKey | SATKUSMIFHRIJS-ZDLRPUJNSA-N |
| XLogP | 6.05 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|