C28H39N3O5Si — CID 10007067
[(4S,5S)-5-[(2S,3S,6S)-3-azido-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10007067) has the molecular formula C28H39N3O5Si and a molecular weight of 525.72 g/mol. Its IUPAC name is [(4S,5S)-5-[(2S,3S,6S)-3-azido-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(4S,5S)-5-[(2S,3S,6S)-3-azido-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10007067 |
| Molecular Formula | C28H39N3O5Si |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [(4S,5S)-5-[(2S,3S,6S)-3-azido-6-methoxyoxan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@@H]1CC[C@H](N=[N+]=[N-])[C@@H]([C@@H]2OC(C)(C)O[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H39N3O5Si/c1-27(2,3)37(20-13-9-7-10-14-20,21-15-11-8-12-16-21)33-19-23-26(36-28(4,5)35-23)25-22(30-31-29)17-18-24(32-6)34-25/h7-16,22-26H,17-19H2,1-6H3/t22-,23-,24-,25-,26+/m0/s1 |
| InChIKey | QEQKVXYZMXAJQH-WBAQKLHDSA-N |
| XLogP | 4.91 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|