C26H35N3O4SSi — CID 58679003
[(3aR,6S,7aR)-7-azido-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 58679003) has the molecular formula C26H35N3O4SSi and a molecular weight of 513.74 g/mol. Its IUPAC name is [(3aR,6S,7aR)-7-azido-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,6S,7aR)-7-azido-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 58679003 |
| Molecular Formula | C26H35N3O4SSi |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [(3aR,6S,7aR)-7-azido-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2C1N=[N+]=[N-] |
| InChI | InChI=1S/C26H35N3O4SSi/c1-25(2,3)35(18-13-9-7-10-14-18,19-15-11-8-12-16-19)30-17-20-22-23(33-26(4,5)32-22)21(28-29-27)24(31-20)34-6/h7-16,20-24H,17H2,1-6H3/t20?,21?,22-,23+,24-/m0/s1 |
| InChIKey | UDGLVQIIXIRRMJ-SWTQAEKKSA-N |
| XLogP | 4.85 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|