C25H33N3O4Si — CID 42597620
[(2S)-2-azido-2-[(4R,5S)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane (PubChem CID 42597620) has the molecular formula C25H33N3O4Si and a molecular weight of 467.64 g/mol. Its IUPAC name is [(2S)-2-azido-2-[(4R,5S)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-2-azido-2-[(4R,5S)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 42597620 |
| Molecular Formula | C25H33N3O4Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [(2S)-2-azido-2-[(4R,5S)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N=[N+]=[N-])[C@@H]([C@@H]2CO2)O1 |
| InChI | InChI=1S/C25H33N3O4Si/c1-24(2,3)33(18-12-8-6-9-13-18,19-14-10-7-11-15-19)30-16-20(27-28-26)22-23(21-17-29-21)32-25(4,5)31-22/h6-15,20-23H,16-17H2,1-5H3/t20-,21-,22+,23+/m0/s1 |
| InChIKey | GALJSLAGLQRADO-MYDTUXCISA-N |
| XLogP | 4.16 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|