C25H33N3O3Si — CID 14018436
[(3aS,4R,6R,6aR)-4-azido-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 14018436) has the molecular formula C25H33N3O3Si and a molecular weight of 451.64 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-azido-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4R,6R,6aR)-4-azido-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 14018436 |
| Molecular Formula | C25H33N3O3Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-azido-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H](N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C25H33N3O3Si/c1-24(2,3)32(19-12-8-6-9-13-19,20-14-10-7-11-15-20)29-17-18-16-21(27-28-26)23-22(18)30-25(4,5)31-23/h6-15,18,21-23H,16-17H2,1-5H3/t18-,21-,22-,23+/m1/s1 |
| InChIKey | OSSOEFOMVYIVQL-HWHRFOGPSA-N |
| XLogP | 4.78 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|