C26H35N3O4Si — CID 46856113
2-[(3aR,5S,6R,6aR)-5-(azidomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 46856113) has the molecular formula C26H35N3O4Si and a molecular weight of 481.67 g/mol. Its IUPAC name is 2-[(3aR,5S,6R,6aR)-5-(azidomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(3aR,5S,6R,6aR)-5-(azidomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 46856113 |
| Molecular Formula | C26H35N3O4Si |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[(3aR,5S,6R,6aR)-5-(azidomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C26H35N3O4Si/c1-25(2,3)34(19-12-8-6-9-13-19,20-14-10-7-11-15-20)30-17-16-21-22(18-28-29-27)31-24-23(21)32-26(4,5)33-24/h6-15,21-24H,16-18H2,1-5H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | LMNQUYBYNVLCGS-MOUTVQLLSA-N |
| XLogP | 4.76 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|