C26H35N3O7SSi — CID 11092937
[(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate (PubChem CID 11092937) has the molecular formula C26H35N3O7SSi and a molecular weight of 561.73 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate.
| Compound Name | [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11092937 |
| Molecular Formula | C26H35N3O7SSi |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@](COS(C)(=O)=O)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C26H35N3O7SSi/c1-24(2,3)38(19-13-9-7-10-14-19,20-15-11-8-12-16-20)33-17-21-26(28-29-27,18-32-37(6,30)31)22-23(34-21)36-25(4,5)35-22/h7-16,21-23H,17-18H2,1-6H3/t21-,22-,23+,26-/m1/s1 |
| InChIKey | OBLKERIZIOPRAA-KWNHSTDBSA-N |
| XLogP | 3.46 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|