C25H34O7SSi — CID 87408960
[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate (PubChem CID 87408960) has the molecular formula C25H34O7SSi and a molecular weight of 506.69 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 87408960 |
| Molecular Formula | C25H34O7SSi |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](OS(C)(=O)=O)[C@H]2O1 |
| InChI | InChI=1S/C25H34O7SSi/c1-24(2,3)34(18-13-9-7-10-14-18,19-15-11-8-12-16-19)28-17-20-21(32-33(6,26)27)22-23(29-20)31-25(4,5)30-22/h7-16,20-23H,17H2,1-6H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | YJQLZUBHVPLZFK-KAOXLYBCSA-N |
| XLogP | 2.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|