C26H36O7SSi — CID 123400128
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate (PubChem CID 123400128) has the molecular formula C26H36O7SSi and a molecular weight of 520.72 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 123400128 |
| Molecular Formula | C26H36O7SSi |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)OC2OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(COS(C)(=O)=O)C2O1 |
| InChI | InChI=1S/C26H36O7SSi/c1-25(2,3)35(19-13-9-7-10-14-19,20-15-11-8-12-16-20)30-18-22-21(17-29-34(6,27)28)23-24(31-22)33-26(4,5)32-23/h7-16,21-24H,17-18H2,1-6H3 |
| InChIKey | DPPAYPOCZDASOS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|