C28H39O5PS2Si — CID 102013009
[(3aR,5S,6R,6aR)-2,2-dimethyl-6-[(2-oxo-1,3,2λ5-dithiaphosphinan-2-yl)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 102013009) has the molecular formula C28H39O5PS2Si and a molecular weight of 578.81 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-6-[(2-oxo-1,3,2λ5-dithiaphosphinan-2-yl)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-[(2-oxo-1,3,2λ5-dithiaphosphinan-2-yl)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102013009 |
| Molecular Formula | C28H39O5PS2Si |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-[(2-oxo-1,3,2λ5-dithiaphosphinan-2-yl)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](CP3(=O)SCCCS3)[C@H]2O1 |
| InChI | InChI=1S/C28H39O5PS2Si/c1-27(2,3)37(21-13-8-6-9-14-21,22-15-10-7-11-16-22)30-19-24-23(20-34(29)35-17-12-18-36-34)25-26(31-24)33-28(4,5)32-25/h6-11,13-16,23-26H,12,17-20H2,1-5H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | JSAYSIRHPIHRBC-VEYUFSJPSA-N |
| XLogP | 6.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|