C26H33N3O6Si — CID 11081803
methyl (3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate (PubChem CID 11081803) has the molecular formula C26H33N3O6Si and a molecular weight of 511.65 g/mol. Its IUPAC name is methyl (3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate.
| Compound Name | methyl (3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 11081803 |
| Molecular Formula | C26H33N3O6Si |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | methyl (3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylate |
| SMILES | COC(=O)[C@]1(N=[N+]=[N-])[C@@H]2OC(C)(C)O[C@@H]2O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33N3O6Si/c1-24(2,3)36(18-13-9-7-10-14-18,19-15-11-8-12-16-19)32-17-20-26(28-29-27,23(30)31-6)21-22(33-20)35-25(4,5)34-21/h7-16,20-22H,17H2,1-6H3/t20-,21-,22+,26-/m1/s1 |
| InChIKey | NSTSVKQGXLMSEJ-ZUVQJFRASA-N |
| XLogP | 3.66 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|