C25H33N3O5Si — CID 15308468
methyl (2S)-2-azido-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 15308468) has the molecular formula C25H33N3O5Si and a molecular weight of 483.64 g/mol. Its IUPAC name is methyl (2S)-2-azido-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl (2S)-2-azido-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 15308468 |
| Molecular Formula | C25H33N3O5Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | methyl (2S)-2-azido-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@@H]1OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H33N3O5Si/c1-24(2,3)34(18-13-9-7-10-14-18,19-15-11-8-12-16-19)31-17-20-22(33-25(4,5)32-20)21(27-28-26)23(29)30-6/h7-16,20-22H,17H2,1-6H3/t20-,21-,22+/m0/s1 |
| InChIKey | IDQGFIAHFQBIJO-FDFHNCONSA-N |
| XLogP | 3.93 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|