C25H33N3O5Si — CID 10939816
[(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol (PubChem CID 10939816) has the molecular formula C25H33N3O5Si and a molecular weight of 483.64 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 10939816 |
| Molecular Formula | C25H33N3O5Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [(3aS,5S,6R,6aS)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@](CO)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C25H33N3O5Si/c1-23(2,3)34(18-12-8-6-9-13-18,19-14-10-7-11-15-19)30-16-20-25(17-29,27-28-26)21-22(31-20)33-24(4,5)32-21/h6-15,20-22,29H,16-17H2,1-5H3/t20-,21-,22+,25-/m1/s1 |
| InChIKey | NIOWDJGOUFUEBB-ILSIFQBBSA-N |
| XLogP | 3.48 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|