C27H37N3O7SSi — CID 154620975
1-[(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl methanesulfonate (PubChem CID 154620975) has the molecular formula C27H37N3O7SSi and a molecular weight of 575.76 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl methanesulfonate.
| Compound Name | 1-[(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 154620975 |
| Molecular Formula | C27H37N3O7SSi |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C27H37N3O7SSi/c1-19(37-38(7,31)32)27(23(29-30-28)22-24(36-27)35-26(5,6)34-22)18-33-39(25(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,19,22-24H,18H2,1-7H3/t19?,22-,23+,24+,27+/m1/s1 |
| InChIKey | LEAHSGBRUXNLEX-MDYKFODSSA-N |
| XLogP | 3.85 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|