C32H39N3O7SSi — CID 90878414
[(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 90878414) has the molecular formula C32H39N3O7SSi and a molecular weight of 637.83 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90878414 |
| Molecular Formula | C32H39N3O7SSi |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | [(3aR,5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C32H39N3O7SSi/c1-23-17-19-24(20-18-23)43(36,37)38-21-32(28(34-35-33)27-29(42-32)41-31(5,6)40-27)22-39-44(30(2,3)4,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-20,27-29H,21-22H2,1-6H3/t27-,28+,29+,32-/m1/s1 |
| InChIKey | VOKDWLVYSPTRDA-AAVCQDEJSA-N |
| XLogP | 5.20 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|