C28H40O8SSi — CID 59751333
[(1S)-1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate (PubChem CID 59751333) has the molecular formula C28H40O8SSi and a molecular weight of 564.77 g/mol. Its IUPAC name is [(1S)-1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 59751333 |
| Molecular Formula | C28H40O8SSi |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(1S)-1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate |
| SMILES | CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@]1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C28H40O8SSi/c1-20(36-37(8,29)30)28(24(31-7)23-25(35-28)34-27(5,6)33-23)19-32-38(26(2,3)4,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,20,23-25H,19H2,1-8H3/t20-,23+,24-,25-,28-/m0/s1 |
| InChIKey | WRPXDBHUNCZEMJ-OVZKUZKXSA-N |
| XLogP | 3.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|