C26H38O8SSi — CID 42597618
[(1R)-1-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] methanesulfonate (PubChem CID 42597618) has the molecular formula C26H38O8SSi and a molecular weight of 538.74 g/mol. Its IUPAC name is [(1R)-1-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] methanesulfonate.
| Compound Name | [(1R)-1-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 42597618 |
| Molecular Formula | C26H38O8SSi |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [(1R)-1-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]([C@@H](CO)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]([C@@H](CO)OS(C)(=O)=O)O1 |
| InChI | InChI=1S/C26H38O8SSi/c1-25(2,3)36(19-13-9-7-10-14-19,20-15-11-8-12-16-20)34-22(18-28)24-23(31-26(4,5)32-24)21(17-27)33-35(6,29)30/h7-16,21-24,27-28H,17-18H2,1-6H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | WUNNBNZLAQFWJM-MOUTVQLLSA-N |
| XLogP | 1.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|