C28H42O6Si — CID 134863667
tert-butyl-[(2S,3S,4R)-5-(1,3-dioxolan-2-yl)-4-methoxy-3-(methoxymethoxy)-4-methylpentan-2-yl]oxy-diphenylsilane (PubChem CID 134863667) has the molecular formula C28H42O6Si and a molecular weight of 502.72 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R)-5-(1,3-dioxolan-2-yl)-4-methoxy-3-(methoxymethoxy)-4-methylpentan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R)-5-(1,3-dioxolan-2-yl)-4-methoxy-3-(methoxymethoxy)-4-methylpentan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 134863667 |
| Molecular Formula | C28H42O6Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | tert-butyl-[(2S,3S,4R)-5-(1,3-dioxolan-2-yl)-4-methoxy-3-(methoxymethoxy)-4-methylpentan-2-yl]oxy-diphenylsilane |
| SMILES | COCO[C@@H]([C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@](C)(CC1OCCO1)OC |
| InChI | InChI=1S/C28H42O6Si/c1-22(26(33-21-29-6)28(5,30-7)20-25-31-18-19-32-25)34-35(27(2,3)4,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22,25-26H,18-21H2,1-7H3/t22-,26-,28+/m0/s1 |
| InChIKey | YZOZTIVLFYMDPT-CVTPTMSISA-N |
| XLogP | 4.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|