C29H38O5Si — CID 135021993
[(3aS,5S,6S,6aS)-6-ethenyl-2,2-dimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 135021993) has the molecular formula C29H38O5Si and a molecular weight of 494.70 g/mol. Its IUPAC name is [(3aS,5S,6S,6aS)-6-ethenyl-2,2-dimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,5S,6S,6aS)-6-ethenyl-2,2-dimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 135021993 |
| Molecular Formula | C29H38O5Si |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(3aS,5S,6S,6aS)-6-ethenyl-2,2-dimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=CCO[C@@]1(C=C)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C29H38O5Si/c1-8-20-30-29(9-2)24(32-26-25(29)33-28(6,7)34-26)21-31-35(27(3,4)5,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h8-19,24-26H,1-2,20-21H2,3-7H3/t24-,25+,26-,29-/m0/s1 |
| InChIKey | YFSMXBKNMDEOII-BVXNIFABSA-N |
| XLogP | 4.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|