C27H40O6Si — CID 134863666
(2R,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)-2-methylpentan-2-ol (PubChem CID 134863666) has the molecular formula C27H40O6Si and a molecular weight of 488.70 g/mol. Its IUPAC name is (2R,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)-2-methylpentan-2-ol.
| Compound Name | (2R,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 134863666 |
| Molecular Formula | C27H40O6Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (2R,3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)-2-methylpentan-2-ol |
| SMILES | COCO[C@@H]([C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@](C)(O)CC1OCCO1 |
| InChI | InChI=1S/C27H40O6Si/c1-21(25(32-20-29-6)27(5,28)19-24-30-17-18-31-24)33-34(26(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,21,24-25,28H,17-20H2,1-6H3/t21-,25-,27+/m0/s1 |
| InChIKey | ZECIMDOQVHQSIH-IDNYDCHQSA-N |
| XLogP | 3.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|