C26H35N3O5Si — CID 91272017
(5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a,6a-tetramethyl-6H-furo[2,3-d][1,3]dioxol-5-ol (PubChem CID 91272017) has the molecular formula C26H35N3O5Si and a molecular weight of 497.67 g/mol. Its IUPAC name is (5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a,6a-tetramethyl-6H-furo[2,3-d][1,3]dioxol-5-ol.
| Compound Name | (5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a,6a-tetramethyl-6H-furo[2,3-d][1,3]dioxol-5-ol |
|---|---|
| PubChem CID | 91272017 |
| Molecular Formula | C26H35N3O5Si |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (5S,6S,6aR)-6-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a,6a-tetramethyl-6H-furo[2,3-d][1,3]dioxol-5-ol |
| SMILES | CC1(C)OC2(C)O[C@](O)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](N=[N+]=[N-])[C@@]2(C)O1 |
| InChI | InChI=1S/C26H35N3O5Si/c1-22(2,3)35(19-14-10-8-11-15-19,20-16-12-9-13-17-20)31-18-26(30)21(28-29-27)24(6)25(7,34-26)33-23(4,5)32-24/h8-17,21,30H,18H2,1-7H3/t21-,24+,25?,26+/m0/s1 |
| InChIKey | RWYTXGQQOZTCTL-IYEALGFDSA-N |
| XLogP | 4.22 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|