C25H35NO5Si — CID 101251516
[(3aR,5R,6S,6aR)-6-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 101251516) has the molecular formula C25H35NO5Si and a molecular weight of 457.64 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-6-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5R,6S,6aR)-6-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 101251516 |
| Molecular Formula | C25H35NO5Si |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [(3aR,5R,6S,6aR)-6-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CC1(C)O[C@H]2O[C@](CO)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](N)[C@H]2O1 |
| InChI | InChI=1S/C25H35NO5Si/c1-23(2,3)32(18-12-8-6-9-13-18,19-14-10-7-11-15-19)28-17-25(16-27)21(26)20-22(31-25)30-24(4,5)29-20/h6-15,20-22,27H,16-17,26H2,1-5H3/t20-,21+,22+,25-/m1/s1 |
| InChIKey | PXNCEMDZLJBMTR-HXKBJWFLSA-N |
| XLogP | 2.13 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|