C26H36O6Si — CID 59072337
[(4R,6R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methanol (PubChem CID 59072337) has the molecular formula C26H36O6Si and a molecular weight of 472.65 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methanol.
| Compound Name | [(4R,6R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methanol |
|---|---|
| PubChem CID | 59072337 |
| Molecular Formula | C26H36O6Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(4R,6R,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methanol |
| SMILES | CO[C@@H]1O[C@](CO)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C26H36O6Si/c1-24(2,3)33(19-13-9-7-10-14-19,20-15-11-8-12-16-20)29-18-26(17-27)22-21(23(28-6)32-26)30-25(4,5)31-22/h7-16,21-23,27H,17-18H2,1-6H3/t21-,22?,23+,26+/m0/s1 |
| InChIKey | KHDLPJBUDNPHMK-KZZIRYEQSA-N |
| XLogP | 2.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|