C32H49N3O5Si2 — CID 10675251
[(2S,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10675251) has the molecular formula C32H49N3O5Si2 and a molecular weight of 611.93 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10675251 |
| Molecular Formula | C32H49N3O5Si2 |
| Molecular Weight | 611.93 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | [(2S,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2N=[N+]=[N-])O1 |
| InChI | InChI=1S/C32H49N3O5Si2/c1-30(2,3)41(9,10)40-29-25(38-28(27(29)34-35-33)26-21-36-32(7,8)39-26)22-37-42(31(4,5)6,23-17-13-11-14-18-23)24-19-15-12-16-20-24/h11-20,25-29H,21-22H2,1-10H3/t25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | OCWUAIKGSSNXJN-MJOVFQHFSA-N |
| XLogP | 6.55 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.93 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|