C29H42O9SSi — CID 59751291
[1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyethyl] methanesulfonate (PubChem CID 59751291) has the molecular formula C29H42O9SSi and a molecular weight of 594.80 g/mol. Its IUPAC name is [1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyethyl] methanesulfonate.
| Compound Name | [1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 59751291 |
| Molecular Formula | C29H42O9SSi |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [1-[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyethyl] methanesulfonate |
| SMILES | COCC(OS(C)(=O)=O)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OC |
| InChI | InChI=1S/C29H42O9SSi/c1-27(2,3)40(21-15-11-9-12-16-21,22-17-13-10-14-18-22)34-20-29(23(19-32-6)38-39(8,30)31)25(33-7)24-26(37-29)36-28(4,5)35-24/h9-18,23-26H,19-20H2,1-8H3/t23?,24-,25+,26+,29+/m1/s1 |
| InChIKey | FEGFNYHMJDQOHV-DJGULCAZSA-N |
| XLogP | 2.82 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|