C25H33N3O4Si — CID 122398056
[(3aR,4S,6S,6aR)-6-[(1S)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 122398056) has the molecular formula C25H33N3O4Si and a molecular weight of 467.64 g/mol. Its IUPAC name is [(3aR,4S,6S,6aR)-6-[(1S)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4S,6S,6aR)-6-[(1S)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 122398056 |
| Molecular Formula | C25H33N3O4Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [(3aR,4S,6S,6aR)-6-[(1S)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C[C@H](N=[N+]=[N-])[C@@H]1O[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C25H33N3O4Si/c1-17(27-28-26)20-21-22(31-25(5,6)30-21)23(29-20)32-33(24(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20-23H,1-6H3/t17-,20-,21+,22+,23-/m0/s1 |
| InChIKey | GSKGALGNIPQFQK-GIFBIUIXSA-N |
| XLogP | 4.51 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|