C35H53N3O3Si — CID 57017900
2-[(6S)-6-[(1R,2S,3R,6S)-1-azido-2,6-dimethyl-3-propylcyclohexyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 57017900) has the molecular formula C35H53N3O3Si and a molecular weight of 591.91 g/mol. Its IUPAC name is 2-[(6S)-6-[(1R,2S,3R,6S)-1-azido-2,6-dimethyl-3-propylcyclohexyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(6S)-6-[(1R,2S,3R,6S)-1-azido-2,6-dimethyl-3-propylcyclohexyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 57017900 |
| Molecular Formula | C35H53N3O3Si |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 591.39 |
| IUPAC Name | 2-[(6S)-6-[(1R,2S,3R,6S)-1-azido-2,6-dimethyl-3-propylcyclohexyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CCC[C@@H]1CC[C@H](C)[C@](N=[N+]=[N-])([C@@H]2CC(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(C)(C)O2)[C@H]1C |
| InChI | InChI=1S/C35H53N3O3Si/c1-9-16-28-22-21-26(2)35(27(28)3,37-38-36)32-25-29(40-34(7,8)41-32)23-24-39-42(33(4,5)6,30-17-12-10-13-18-30)31-19-14-11-15-20-31/h10-15,17-20,26-29,32H,9,16,21-25H2,1-8H3/t26-,27-,28+,29?,32-,35+/m0/s1 |
| InChIKey | ZYSWPYXDZCNOKM-AWVLZIRDSA-N |
| XLogP | 8.39 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|