C27H39N3O6Si — CID 101371344
[(2R,3S,4S,6S)-4-azido-6-methoxy-3-(2-methoxyethoxymethoxy)oxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 101371344) has the molecular formula C27H39N3O6Si and a molecular weight of 529.71 g/mol. Its IUPAC name is [(2R,3S,4S,6S)-4-azido-6-methoxy-3-(2-methoxyethoxymethoxy)oxan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3S,4S,6S)-4-azido-6-methoxy-3-(2-methoxyethoxymethoxy)oxan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101371344 |
| Molecular Formula | C27H39N3O6Si |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | [(2R,3S,4S,6S)-4-azido-6-methoxy-3-(2-methoxyethoxymethoxy)oxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | COCCOCO[C@H]1[C@@H](N=[N+]=[N-])C[C@@H](OC)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H39N3O6Si/c1-27(2,3)37(21-12-8-6-9-13-21,22-14-10-7-11-15-22)35-19-24-26(34-20-33-17-16-31-4)23(29-30-28)18-25(32-5)36-24/h6-15,23-26H,16-20H2,1-5H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | BHKFIELIGNFPPX-QYOOZWMWSA-N |
| XLogP | 4.01 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|