C22H31N3O3Si — CID 71514366
(2R,3S)-2-azido-6-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol (PubChem CID 71514366) has the molecular formula C22H31N3O3Si and a molecular weight of 413.59 g/mol. Its IUPAC name is (2R,3S)-2-azido-6-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol.
| Compound Name | (2R,3S)-2-azido-6-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol |
|---|---|
| PubChem CID | 71514366 |
| Molecular Formula | C22H31N3O3Si |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2R,3S)-2-azido-6-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol |
| SMILES | CC(C)(C)[Si](OCCC[C@H](O)[C@@H](CO)N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31N3O3Si/c1-22(2,3)29(18-11-6-4-7-12-18,19-13-8-5-9-14-19)28-16-10-15-21(27)20(17-26)24-25-23/h4-9,11-14,20-21,26-27H,10,15-17H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | NVBUOUNOHRPNEI-RTWAWAEBSA-N |
| XLogP | 3.38 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|