C29H45N3O2Si — CID 59087832
(3R)-1-[2-azido-3-[tert-butyl(diphenyl)silyl]propoxy]decan-3-ol (PubChem CID 59087832) has the molecular formula C29H45N3O2Si and a molecular weight of 495.78 g/mol. Its IUPAC name is (3R)-1-[2-azido-3-[tert-butyl(diphenyl)silyl]propoxy]decan-3-ol.
| Compound Name | (3R)-1-[2-azido-3-[tert-butyl(diphenyl)silyl]propoxy]decan-3-ol |
|---|---|
| PubChem CID | 59087832 |
| Molecular Formula | C29H45N3O2Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (3R)-1-[2-azido-3-[tert-butyl(diphenyl)silyl]propoxy]decan-3-ol |
| SMILES | CCCCCCC[C@@H](O)CCOCC(C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C29H45N3O2Si/c1-5-6-7-8-11-16-26(33)21-22-34-23-25(31-32-30)24-35(29(2,3)4,27-17-12-9-13-18-27)28-19-14-10-15-20-28/h9-10,12-15,17-20,25-26,33H,5-8,11,16,21-24H2,1-4H3/t25?,26-/m1/s1 |
| InChIKey | WTSRAGOGFFZZLV-FXDYGKIASA-N |
| XLogP | 6.86 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|