C31H49N3O4Si — CID 59055125
[2-azido-3-[(3R)-3-(methoxymethoxy)decoxy]propoxy]-tert-butyl-diphenylsilane (PubChem CID 59055125) has the molecular formula C31H49N3O4Si and a molecular weight of 555.84 g/mol. Its IUPAC name is [2-azido-3-[(3R)-3-(methoxymethoxy)decoxy]propoxy]-tert-butyl-diphenylsilane.
| Compound Name | [2-azido-3-[(3R)-3-(methoxymethoxy)decoxy]propoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59055125 |
| Molecular Formula | C31H49N3O4Si |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | [2-azido-3-[(3R)-3-(methoxymethoxy)decoxy]propoxy]-tert-butyl-diphenylsilane |
| SMILES | CCCCCCC[C@H](CCOCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-])OCOC |
| InChI | InChI=1S/C31H49N3O4Si/c1-6-7-8-9-12-17-28(37-26-35-5)22-23-36-24-27(33-34-32)25-38-39(31(2,3)4,29-18-13-10-14-19-29)30-20-15-11-16-21-30/h10-11,13-16,18-21,27-28H,6-9,12,17,22-26H2,1-5H3/t27?,28-/m1/s1 |
| InChIKey | XAAWIYOMHYRYED-PLYLYKGUSA-N |
| XLogP | 7.00 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|