C23H31N3O3Si — CID 10895181
[(2R)-2-azido-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane (PubChem CID 10895181) has the molecular formula C23H31N3O3Si and a molecular weight of 425.61 g/mol. Its IUPAC name is [(2R)-2-azido-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-2-azido-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10895181 |
| Molecular Formula | C23H31N3O3Si |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | [(2R)-2-azido-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC[C@@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N=[N+]=[N-])O1 |
| InChI | InChI=1S/C23H31N3O3Si/c1-22(2,3)30(18-12-8-6-9-13-18,19-14-10-7-11-15-19)28-16-20(25-26-24)21-17-27-23(4,5)29-21/h6-15,20-21H,16-17H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | CXFCSYSBAJOVPU-RTWAWAEBSA-N |
| XLogP | 4.39 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|