C20H25N3O2Si — CID 11783542
[(2R)-2-azido-2-[(2R)-oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane (PubChem CID 11783542) has the molecular formula C20H25N3O2Si and a molecular weight of 367.53 g/mol. Its IUPAC name is [(2R)-2-azido-2-[(2R)-oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-2-azido-2-[(2R)-oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11783542 |
| Molecular Formula | C20H25N3O2Si |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [(2R)-2-azido-2-[(2R)-oxiran-2-yl]ethoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H](N=[N+]=[N-])[C@@H]1CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2Si/c1-20(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-14-18(22-23-21)19-15-24-19/h4-13,18-19H,14-15H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | ZFBRYPOOTGYALU-MOPGFXCFSA-N |
| XLogP | 3.64 |
| TPSA | 70.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|