C19H24N2OSi — CID 164713947
tert-butyl-[1-((1,2-15N2)3H-diazirin-3-yl)ethoxy]-diphenylsilane (PubChem CID 164713947) has the molecular formula C19H24N2OSi and a molecular weight of 326.49 g/mol. Its IUPAC name is tert-butyl-[1-((1,2-15N2)3H-diazirin-3-yl)ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[1-((1,2-15N2)3H-diazirin-3-yl)ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164713947 |
| Molecular Formula | C19H24N2OSi |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl-[1-((1,2-15N2)3H-diazirin-3-yl)ethoxy]-diphenylsilane |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1[15N]=[15N]1 |
| InChI | InChI=1S/C19H24N2OSi/c1-15(18-20-21-18)22-23(19(2,3)4,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15,18H,1-4H3/i20+1,21+1 |
| InChIKey | ZWCFECJEGMVYBY-FUUDAMAOSA-N |
| XLogP | 3.74 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|