C36H57N3O3Si — CID 11954958
[(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-(11-methyldodecyl)-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane (PubChem CID 11954958) has the molecular formula C36H57N3O3Si and a molecular weight of 607.96 g/mol. Its IUPAC name is [(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-(11-methyldodecyl)-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-(11-methyldodecyl)-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11954958 |
| Molecular Formula | C36H57N3O3Si |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | [(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-(11-methyldodecyl)-1,3-dioxolan-4-yl]ethoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)CCCCCCCCCC[C@H]1OC(C)(C)O[C@H]1[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C36H57N3O3Si/c1-29(2)22-16-12-10-8-9-11-13-21-27-33-34(42-36(6,7)41-33)32(38-39-37)28-40-43(35(3,4)5,30-23-17-14-18-24-30)31-25-19-15-20-26-31/h14-15,17-20,23-26,29,32-34H,8-13,16,21-22,27-28H2,1-7H3/t32-,33+,34-/m0/s1 |
| InChIKey | LJWRLOUCYXEYHW-GMTSZFNJSA-N |
| XLogP | 9.32 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|