C25H32N6O2 — CID 10599597
(4S,5S)-4,5-bis[(1R)-1-azido-4-phenylbutyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10599597) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is (4S,5S)-4,5-bis[(1R)-1-azido-4-phenylbutyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4,5-bis[(1R)-1-azido-4-phenylbutyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10599597 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (4S,5S)-4,5-bis[(1R)-1-azido-4-phenylbutyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H]([C@@H](CCCc2ccccc2)N=[N+]=[N-])[C@H]([C@@H](CCCc2ccccc2)N=[N+]=[N-])O1 |
| InChI | InChI=1S/C25H32N6O2/c1-25(2)32-23(21(28-30-26)17-9-15-19-11-5-3-6-12-19)24(33-25)22(29-31-27)18-10-16-20-13-7-4-8-14-20/h3-8,11-14,21-24H,9-10,15-18H2,1-2H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | JGVAVERHRQNZTC-LWSSLDFYSA-N |
| XLogP | 6.91 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|