C28H37N3O4Si — CID 176734969
[(3aR,4R,7R,7aR)-7-azido-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 176734969) has the molecular formula C28H37N3O4Si and a molecular weight of 507.71 g/mol. Its IUPAC name is [(3aR,4R,7R,7aR)-7-azido-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4R,7R,7aR)-7-azido-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 176734969 |
| Molecular Formula | C28H37N3O4Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(3aR,4R,7R,7aR)-7-azido-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=CCC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H37N3O4Si/c1-7-14-22-24(30-31-29)26-25(34-28(5,6)35-26)23(33-22)19-32-36(27(2,3)4,20-15-10-8-11-16-20)21-17-12-9-13-18-21/h7-13,15-18,22-26H,1,14,19H2,2-6H3/t22?,23-,24-,25+,26-/m1/s1 |
| InChIKey | NXVZJPHZQDQUBA-YWNBMJLQSA-N |
| XLogP | 5.11 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|