C31H41NO5Si — CID 176734980
1-[(1R,2R,6R,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8-trioxa-14-azatricyclo[7.5.0.02,6]tetradec-11-en-14-yl]ethanone (PubChem CID 176734980) has the molecular formula C31H41NO5Si and a molecular weight of 535.76 g/mol. Its IUPAC name is 1-[(1R,2R,6R,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8-trioxa-14-azatricyclo[7.5.0.02,6]tetradec-11-en-14-yl]ethanone.
| Compound Name | 1-[(1R,2R,6R,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8-trioxa-14-azatricyclo[7.5.0.02,6]tetradec-11-en-14-yl]ethanone |
|---|---|
| PubChem CID | 176734980 |
| Molecular Formula | C31H41NO5Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 1-[(1R,2R,6R,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8-trioxa-14-azatricyclo[7.5.0.02,6]tetradec-11-en-14-yl]ethanone |
| SMILES | CC(=O)N1CC=CCC2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C31H41NO5Si/c1-22(33)32-20-14-13-19-25-27(32)29-28(36-31(5,6)37-29)26(35-25)21-34-38(30(2,3)4,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7-18,25-29H,19-21H2,1-6H3/t25?,26-,27-,28+,29-/m1/s1 |
| InChIKey | VCRVWMCIMLYMJD-GCCWHXRWSA-N |
| XLogP | 4.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|